C23H44N2O5S — CID 58840515
(2S)-N-[(1R)-1-[(2R,3R,4S,5R,6R)-6-tert-butylsulfanyl-3,4,5-trihydroxyoxan-2-yl]-2-methylpropyl]-5-propylazepane-2-carboxamide (PubChem CID 58840515) has the molecular formula C23H44N2O5S and a molecular weight of 460.68 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-[(2R,3R,4S,5R,6R)-6-tert-butylsulfanyl-3,4,5-trihydroxyoxan-2-yl]-2-methylpropyl]-5-propylazepane-2-carboxamide.
| Compound Name | (2S)-N-[(1R)-1-[(2R,3R,4S,5R,6R)-6-tert-butylsulfanyl-3,4,5-trihydroxyoxan-2-yl]-2-methylpropyl]-5-propylazepane-2-carboxamide |
|---|---|
| PubChem CID | 58840515 |
| Molecular Formula | C23H44N2O5S |
| Molecular Weight | 460.68 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2S)-N-[(1R)-1-[(2R,3R,4S,5R,6R)-6-tert-butylsulfanyl-3,4,5-trihydroxyoxan-2-yl]-2-methylpropyl]-5-propylazepane-2-carboxamide |
| SMILES | CCCC1CCN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC(C)(C)C)[C@H](O)[C@@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C23H44N2O5S/c1-7-8-14-9-10-15(24-12-11-14)21(29)25-16(13(2)3)20-18(27)17(26)19(28)22(30-20)31-23(4,5)6/h13-20,22,24,26-28H,7-12H2,1-6H3,(H,25,29)/t14?,15-,16+,17-,18+,19+,20+,22+/m0/s1 |
| InChIKey | IILFYPZVGYQYFN-ZBJNKSLVSA-N |
| XLogP | 2.02 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |