About 2-butylsulfinylphenol
2-butylsulfinylphenol (PubChem CID 588406) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-butylsulfinylphenol.
Molecular Properties
| Compound Name | 2-butylsulfinylphenol |
| PubChem CID | 588406 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-butylsulfinylphenol |
| SMILES | CCCCS(=O)c1ccccc1O |
| InChI | InChI=1S/C10H14O2S/c1-2-3-8-13(12)10-7-5-4-6-9(10)11/h4-7,11H,2-3,8H2,1H3 |
| InChIKey | CUSDNDXVBDKEDY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butylsulfinylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfinylphenol?
The IUPAC name of 2-butylsulfinylphenol (CID 588406) is 2-butylsulfinylphenol.
What is the SMILES notation for 2-butylsulfinylphenol?
The canonical SMILES for 2-butylsulfinylphenol is CCCCS(=O)c1ccccc1O.
What is the InChIKey of 2-butylsulfinylphenol?
The InChIKey is CUSDNDXVBDKEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2S/c1-2-3-8-13(12)10-7-5-4-6-9(10)11/h4-7,11H,2-3,8H2,1H3.
What are the key properties of 2-butylsulfinylphenol?
2-butylsulfinylphenol has a molecular weight of 198.29 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfinylphenol is sourced from PubChem (CID 588406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).