C18H30F2N2O5S — CID 58840622
(2S,4R)-4-(3,3-difluoroprop-2-enyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide (PubChem CID 58840622) has the molecular formula C18H30F2N2O5S and a molecular weight of 424.51 g/mol. Its IUPAC name is (2S,4R)-4-(3,3-difluoroprop-2-enyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(3,3-difluoroprop-2-enyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58840622 |
| Molecular Formula | C18H30F2N2O5S |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2S,4R)-4-(3,3-difluoroprop-2-enyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]pyrrolidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@@H](CC=C(F)F)CN2)C(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H30F2N2O5S/c1-8(2)12(16-14(24)13(23)15(25)18(27-16)28-3)22-17(26)10-6-9(7-21-10)4-5-11(19)20/h5,8-10,12-16,18,21,23-25H,4,6-7H2,1-3H3,(H,22,26)/t9-,10+,12-,13+,14-,15-,16-,18-/m1/s1 |
| InChIKey | FODCKRISDKAXNE-SLSHDILDSA-N |
| XLogP | 0.45 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |