About (6-chloro-3-pyridinyl) N-methylmethanimidate
(6-chloro-3-pyridinyl) N-methylmethanimidate (PubChem CID 58840784) has the molecular formula C7H7ClN2O
and a molecular weight of 170.60 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl) N-methylmethanimidate.
Molecular Properties
| Compound Name | (6-chloro-3-pyridinyl) N-methylmethanimidate |
| PubChem CID | 58840784 |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | (6-chloro-3-pyridinyl) N-methylmethanimidate |
| SMILES | C/N=C/Oc1ccc(Cl)nc1 |
| InChI | InChI=1S/C7H7ClN2O/c1-9-5-11-6-2-3-7(8)10-4-6/h2-5H,1H3/b9-5+ |
| InChIKey | QFYYXIIARAEDRU-WEVVVXLNSA-N |
| XLogP | 1.77 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-3-pyridinyl) N-methylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-pyridinyl) N-methylmethanimidate?
The IUPAC name of (6-chloro-3-pyridinyl) N-methylmethanimidate (CID 58840784) is (6-chloro-3-pyridinyl) N-methylmethanimidate.
What is the SMILES notation for (6-chloro-3-pyridinyl) N-methylmethanimidate?
The canonical SMILES for (6-chloro-3-pyridinyl) N-methylmethanimidate is C/N=C/Oc1ccc(Cl)nc1.
What is the InChIKey of (6-chloro-3-pyridinyl) N-methylmethanimidate?
The InChIKey is QFYYXIIARAEDRU-WEVVVXLNSA-N. The full InChI is InChI=1S/C7H7ClN2O/c1-9-5-11-6-2-3-7(8)10-4-6/h2-5H,1H3/b9-5+.
What are the key properties of (6-chloro-3-pyridinyl) N-methylmethanimidate?
(6-chloro-3-pyridinyl) N-methylmethanimidate has a molecular weight of 170.60 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-pyridinyl) N-methylmethanimidate is sourced from PubChem (CID 58840784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).