C21H22ClIN6O3S — CID 58840827
4-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N,2,2-trimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxole-4-carboxamide (PubChem CID 58840827) has the molecular formula C21H22ClIN6O3S and a molecular weight of 600.87 g/mol. Its IUPAC name is 4-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N,2,2-trimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxole-4-carboxamide.
| Compound Name | 4-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N,2,2-trimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxole-4-carboxamide |
|---|---|
| PubChem CID | 58840827 |
| Molecular Formula | C21H22ClIN6O3S |
| Molecular Weight | 600.87 g/mol |
| Exact Mass | 600.02 |
| IUPAC Name | 4-[2-chloro-6-[(3-iodophenyl)methylamino]purin-9-yl]-N,2,2-trimethyl-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxole-4-carboxamide |
| SMILES | CNC(=O)C1(n2cnc3c(NCc4cccc(I)c4)nc(Cl)nc32)SCC2OC(C)(C)OC21 |
| InChI | InChI=1S/C21H22ClIN6O3S/c1-20(2)31-13-9-33-21(15(13)32-20,18(30)24-3)29-10-26-14-16(27-19(22)28-17(14)29)25-8-11-5-4-6-12(23)7-11/h4-7,10,13,15H,8-9H2,1-3H3,(H,24,30)(H,25,27,28) |
| InChIKey | DOTSASMJLUEXSI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|