C22H20N4O8 — CID 58840943
2-[[4-[[(Z)-3-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenoxy]prop-1-enoxy]methyl]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 58840943) has the molecular formula C22H20N4O8 and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-[[4-[[(Z)-3-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenoxy]prop-1-enoxy]methyl]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione.
| Compound Name | 2-[[4-[[(Z)-3-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenoxy]prop-1-enoxy]methyl]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 58840943 |
| Molecular Formula | C22H20N4O8 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[[4-[[(Z)-3-[4-[(3,5-dioxo-1,2,4-oxadiazolidin-2-yl)methyl]phenoxy]prop-1-enoxy]methyl]phenyl]methyl]-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(CO/C=C\COc3ccc(Cn4oc(=O)[nH]c4=O)cc3)cc2)o1 |
| InChI | InChI=1S/C22H20N4O8/c27-19-23-21(29)33-25(19)12-15-2-4-17(5-3-15)14-31-10-1-11-32-18-8-6-16(7-9-18)13-26-20(28)24-22(30)34-26/h1-10H,11-14H2,(H,23,27,29)(H,24,28,30)/b10-1- |
| InChIKey | IHLUQPMNPAFKDR-LAFDYMOFSA-N |
| XLogP | 0.78 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|