About 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate
4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate (PubChem CID 58840962) has the molecular formula C18H31N3O7S
and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate |
| PubChem CID | 58840962 |
| Molecular Formula | C18H31N3O7S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate |
| SMILES | CC(=O)NC(CSC(=O)CC1(CN)CCCCC1)C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C18H31N3O7S/c1-14(22)20-15(17(24)27-9-5-6-10-28-21(25)26)12-29-16(23)11-18(13-19)7-3-2-4-8-18/h15H,2-13,19H2,1H3,(H,20,22) |
| InChIKey | TVZIHFXYLUCAJT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate?
The IUPAC name of 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate (CID 58840962) is 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate.
What is the SMILES notation for 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate?
The canonical SMILES for 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate is CC(=O)NC(CSC(=O)CC1(CN)CCCCC1)C(=O)OCCCCO[N+](=O)[O-].
What is the InChIKey of 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate?
The InChIKey is TVZIHFXYLUCAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O7S/c1-14(22)20-15(17(24)27-9-5-6-10-28-21(25)26)12-29-16(23)11-18(13-19)7-3-2-4-8-18/h15H,2-13,19H2,1H3,(H,20,22).
What are the key properties of 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate?
4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate has a molecular weight of 433.53 g/mol, XLogP of 1.58, 13 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrooxybutyl 2-acetamido-3-[2-[1-(aminomethyl)cyclohexyl]acetyl]sulfanylpropanoate is sourced from PubChem (CID 58840962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).