C7H16N2 — CID 58841122
(1,3-dimethylpyrrolidin-2-yl)methanamine (PubChem CID 58841122) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (1,3-dimethylpyrrolidin-2-yl)methanamine.
| Compound Name | (1,3-dimethylpyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 58841122 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (1,3-dimethylpyrrolidin-2-yl)methanamine |
| SMILES | CC1CCN(C)C1CN |
| InChI | InChI=1S/C7H16N2/c1-6-3-4-9(2)7(6)5-8/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | KVODZTBQMRDDAS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |