About 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide
3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide (PubChem CID 58841265) has the molecular formula C14H21N3O5
and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide |
| PubChem CID | 58841265 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide |
| SMILES | CCOCCC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H21N3O5/c1-2-22-10-6-12(19)16-8-7-15-11(18)5-9-17-13(20)3-4-14(17)21/h3-4H,2,5-10H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | PJKMLIHKGMLBCJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide (CID 58841265) is 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide is CCOCCC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide?
The InChIKey is PJKMLIHKGMLBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O5/c1-2-22-10-6-12(19)16-8-7-15-11(18)5-9-17-13(20)3-4-14(17)21/h3-4H,2,5-10H2,1H3,(H,15,18)(H,16,19).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide?
3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide has a molecular weight of 311.34 g/mol, XLogP of -1.04, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-N-[2-(3-ethoxypropanoylamino)ethyl]propanamide is sourced from PubChem (CID 58841265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).