C35H51N9O13 — CID 58841294
ethyl N-[1-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 58841294) has the molecular formula C35H51N9O13 and a molecular weight of 805.84 g/mol. Its IUPAC name is ethyl N-[1-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58841294 |
| Molecular Formula | C35H51N9O13 |
| Molecular Weight | 805.84 g/mol |
| Exact Mass | 805.36 |
| IUPAC Name | ethyl N-[1-[[1,5-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OCC)C(=O)NC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C35H51N9O13/c1-3-56-34(54)40-14-6-5-7-24(42-35(55)57-4-2)33(53)41-23(21-27(47)38-17-15-36-25(45)12-19-43-29(49)8-9-30(43)50)22-28(48)39-18-16-37-26(46)13-20-44-31(51)10-11-32(44)52/h8-11,23-24H,3-7,12-22H2,1-2H3,(H,36,45)(H,37,46)(H,38,47)(H,39,48)(H,40,54)(H,41,53)(H,42,55) |
| InChIKey | CJCCPWOQGVWSEO-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 296.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.84 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|