C23H50O4Si3 — CID 58841437
[dimethyl(2-trimethoxysilylethyl)silyl]oxy-[(4Z)-3-ethyl-4,8-dimethyldeca-4,9-dienyl]-dimethylsilane (PubChem CID 58841437) has the molecular formula C23H50O4Si3 and a molecular weight of 474.91 g/mol. Its IUPAC name is [dimethyl(2-trimethoxysilylethyl)silyl]oxy-[(4Z)-3-ethyl-4,8-dimethyldeca-4,9-dienyl]-dimethylsilane.
| Compound Name | [dimethyl(2-trimethoxysilylethyl)silyl]oxy-[(4Z)-3-ethyl-4,8-dimethyldeca-4,9-dienyl]-dimethylsilane |
|---|---|
| PubChem CID | 58841437 |
| Molecular Formula | C23H50O4Si3 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [dimethyl(2-trimethoxysilylethyl)silyl]oxy-[(4Z)-3-ethyl-4,8-dimethyldeca-4,9-dienyl]-dimethylsilane |
| SMILES | C=CC(C)CC/C=C(/C)C(CC)CC[Si](C)(C)O[Si](C)(C)CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C23H50O4Si3/c1-12-21(3)15-14-16-22(4)23(13-2)17-18-28(8,9)27-29(10,11)19-20-30(24-5,25-6)26-7/h12,16,21,23H,1,13-15,17-20H2,2-11H3/b22-16- |
| InChIKey | PWBIKQODGGONDY-JWGURIENSA-N |
| XLogP | 7.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|