C9H12N4O3S — CID 58842898
5-[(3-hydrazinylphenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 58842898) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is 5-[(3-hydrazinylphenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(3-hydrazinylphenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 58842898 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-[(3-hydrazinylphenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | NNc1cccc(CN2CC(=O)NS2(=O)=O)c1 |
| InChI | InChI=1S/C9H12N4O3S/c10-11-8-3-1-2-7(4-8)5-13-6-9(14)12-17(13,15)16/h1-4,11H,5-6,10H2,(H,12,14) |
| InChIKey | XARWXFRUQOVBIM-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|