C24H19N3O2 — CID 58842913
N-(3-benzamido-4-methylphenyl)quinoline-7-carboxamide (PubChem CID 58842913) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(3-benzamido-4-methylphenyl)quinoline-7-carboxamide.
| Compound Name | N-(3-benzamido-4-methylphenyl)quinoline-7-carboxamide |
|---|---|
| PubChem CID | 58842913 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(3-benzamido-4-methylphenyl)quinoline-7-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3cccnc3c2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O2/c1-16-9-12-20(15-21(16)27-23(28)18-6-3-2-4-7-18)26-24(29)19-11-10-17-8-5-13-25-22(17)14-19/h2-15H,1H3,(H,26,29)(H,27,28) |
| InChIKey | QAYKDYPTQBJERW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |