C13H25O4P — CID 58843227
[(2E,4E)-3,4,8,8-tetramethylnona-2,4-dienyl] dihydrogen phosphate (PubChem CID 58843227) has the molecular formula C13H25O4P and a molecular weight of 276.31 g/mol. Its IUPAC name is [(2E,4E)-3,4,8,8-tetramethylnona-2,4-dienyl] dihydrogen phosphate.
| Compound Name | [(2E,4E)-3,4,8,8-tetramethylnona-2,4-dienyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58843227 |
| Molecular Formula | C13H25O4P |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(2E,4E)-3,4,8,8-tetramethylnona-2,4-dienyl] dihydrogen phosphate |
| SMILES | CC(=C\CCC(C)(C)C)/C(C)=C/COP(=O)(O)O |
| InChI | InChI=1S/C13H25O4P/c1-11(7-6-9-13(3,4)5)12(2)8-10-17-18(14,15)16/h7-8H,6,9-10H2,1-5H3,(H2,14,15,16)/b11-7+,12-8+ |
| InChIKey | KAAPFUFCOUXEQG-MKICQXMISA-N |
| XLogP | 3.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|