C77H76N5O5+5 — CID 58843286
4-[(11S)-5,6,9,10-tetrakis(4-formylphenyl)-3,4,7,8,11-pentakis(1-methylpyridin-1-ium-4-yl)dodecan-2-yl]benzaldehyde (PubChem CID 58843286) has the molecular formula C77H76N5O5+5 and a molecular weight of 1151.48 g/mol. Its IUPAC name is 4-[(11S)-5,6,9,10-tetrakis(4-formylphenyl)-3,4,7,8,11-pentakis(1-methylpyridin-1-ium-4-yl)dodecan-2-yl]benzaldehyde.
| Compound Name | 4-[(11S)-5,6,9,10-tetrakis(4-formylphenyl)-3,4,7,8,11-pentakis(1-methylpyridin-1-ium-4-yl)dodecan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 58843286 |
| Molecular Formula | C77H76N5O5+5 |
| Molecular Weight | 1151.48 g/mol |
| Exact Mass | 1150.58 |
| IUPAC Name | 4-[(11S)-5,6,9,10-tetrakis(4-formylphenyl)-3,4,7,8,11-pentakis(1-methylpyridin-1-ium-4-yl)dodecan-2-yl]benzaldehyde |
| SMILES | CC(c1ccc(C=O)cc1)C(c1cc[n+](C)cc1)C(c1cc[n+](C)cc1)C(c1ccc(C=O)cc1)C(c1ccc(C=O)cc1)C(c1cc[n+](C)cc1)C(c1cc[n+](C)cc1)C(c1ccc(C=O)cc1)C(c1ccc(C=O)cc1)[C@H](C)c1cc[n+](C)cc1 |
| InChI | InChI=1S/C77H76N5O5/c1-53(60-18-8-55(48-83)9-19-60)71(66-30-40-79(4)41-31-66)73(67-32-42-80(5)43-33-67)74(64-24-14-58(51-86)15-25-64)75(65-26-16-59(52-87)17-27-65)77(69-36-46-82(7)47-37-69)76(68-34-44-81(6)45-35-68)72(63-22-12-57(50-85)13-23-63)70(62-20-10-56(49-84)11-21-62)54(2)61-28-38-78(3)39-29-61/h8-54,70-77H,1-7H3/q+5/t53?,54-,70?,71?,72?,73?,74?,75?,76?,77?/m1/s1 |
| InChIKey | BUYAKPORDFPSOC-MILOCXRDSA-N |
| XLogP | 12.05 |
| TPSA | 104.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.48 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|