C53H54O5S — CID 58843473
(2S,3S,4R,5R,6R)-2-[3-[(5-tert-butyl-1-benzothiophen-2-yl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 58843473) has the molecular formula C53H54O5S and a molecular weight of 803.08 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[3-[(5-tert-butyl-1-benzothiophen-2-yl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4R,5R,6R)-2-[3-[(5-tert-butyl-1-benzothiophen-2-yl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 58843473 |
| Molecular Formula | C53H54O5S |
| Molecular Weight | 803.08 g/mol |
| Exact Mass | 802.37 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[3-[(5-tert-butyl-1-benzothiophen-2-yl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CC(C)(C)c1ccc2sc(Cc3cccc([C@@H]4O[C@H](COCc5ccccc5)[C@@H](OCc5ccccc5)[C@H](OCc5ccccc5)[C@H]4OCc4ccccc4)c3)cc2c1 |
| InChI | InChI=1S/C53H54O5S/c1-53(2,3)45-27-28-48-44(31-45)32-46(59-48)30-42-25-16-26-43(29-42)49-51(56-35-40-21-12-6-13-22-40)52(57-36-41-23-14-7-15-24-41)50(55-34-39-19-10-5-11-20-39)47(58-49)37-54-33-38-17-8-4-9-18-38/h4-29,31-32,47,49-52H,30,33-37H2,1-3H3/t47-,49+,50-,51+,52+/m1/s1 |
| InChIKey | XMZUEYNNYBEMQF-YFSBCMQPSA-N |
| XLogP | 12.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.08 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |