C17H20N2O5 — CID 58843551
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(pyrazin-2-ylmethyl)phenyl]oxane-3,4,5-triol (PubChem CID 58843551) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(pyrazin-2-ylmethyl)phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(pyrazin-2-ylmethyl)phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58843551 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(pyrazin-2-ylmethyl)phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cccc(Cc3cnccn3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20N2O5/c20-9-13-14(21)15(22)16(23)17(24-13)11-3-1-2-10(6-11)7-12-8-18-4-5-19-12/h1-6,8,13-17,20-23H,7,9H2/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | ILFZRYWKCLJIMC-UUAJXVIYSA-N |
| XLogP | -0.42 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |