C22H25NO5 — CID 58843565
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(1-methylindol-2-yl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 58843565) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(1-methylindol-2-yl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(1-methylindol-2-yl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58843565 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(1-methylindol-2-yl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cn1c(Cc2cccc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc2ccccc21 |
| InChI | InChI=1S/C22H25NO5/c1-23-16(11-14-6-2-3-8-17(14)23)10-13-5-4-7-15(9-13)22-21(27)20(26)19(25)18(12-24)28-22/h2-9,11,18-22,24-27H,10,12H2,1H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | OMNBRIHTABQUQA-BDHVOXNPSA-N |
| XLogP | 1.28 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |