C15H12N2O — CID 58843995
(2S)-spiro[1,3-dihydroindole-2,2'-1,4-benzoxazine] (PubChem CID 58843995) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is (2S)-spiro[1,3-dihydroindole-2,2'-1,4-benzoxazine].
| Compound Name | (2S)-spiro[1,3-dihydroindole-2,2'-1,4-benzoxazine] |
|---|---|
| PubChem CID | 58843995 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2S)-spiro[1,3-dihydroindole-2,2'-1,4-benzoxazine] |
| SMILES | C1=Nc2ccccc2O[C@@]12Cc1ccccc1N2 |
| InChI | InChI=1S/C15H12N2O/c1-2-6-12-11(5-1)9-15(17-12)10-16-13-7-3-4-8-14(13)18-15/h1-8,10,17H,9H2/t15-/m0/s1 |
| InChIKey | HKTQIVNMRROVQK-HNNXBMFYSA-N |
| XLogP | 3.15 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |