C31H51O8- — CID 58844102
7-ethoxy-4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]butyl]-7-oxoheptanoate (PubChem CID 58844102) has the molecular formula C31H51O8- and a molecular weight of 551.74 g/mol. Its IUPAC name is 7-ethoxy-4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]butyl]-7-oxoheptanoate.
| Compound Name | 7-ethoxy-4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]butyl]-7-oxoheptanoate |
|---|---|
| PubChem CID | 58844102 |
| Molecular Formula | C31H51O8- |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.36 |
| IUPAC Name | 7-ethoxy-4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]butyl]-7-oxoheptanoate |
| SMILES | CCOC(=O)C(C)(C)CC(C)(CC(C)(CC(C)(CC)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)[O-])C(=O)OC |
| InChI | InChI=1S/C31H52O8/c1-12-28(7,25(36)39-21-16-20-14-15-31(21,10)27(20,5)6)18-29(8,22(32)33)19-30(9,24(35)37-11)17-26(3,4)23(34)38-13-2/h20-21H,12-19H2,1-11H3,(H,32,33)/p-1 |
| InChIKey | UHJQQOJETDGJAN-UHFFFAOYSA-M |
| XLogP | 4.86 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|