4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid

C8H9FN2O4 — CID 58844107

IUPAC4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid
SMILESO=C(O)CCCn1c(=O)[nH]cc(F)c1=O
InChIInChI=1S/C8H9FN2O4/c9-5-4-10-8(15)11(7(5)14)3-1-2-6(12)13/h4H,1-3H2,(H,10,15)(H,12,13)
InChIKeyGAJZWVAXOWHLAX-UHFFFAOYSA-N
MW216.17 g/mol
LogP-0.46
Rot. Bonds4

About 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid

4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid (PubChem CID 58844107) has the molecular formula C8H9FN2O4 and a molecular weight of 216.17 g/mol. Its IUPAC name is 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid
PubChem CID58844107
Molecular FormulaC8H9FN2O4
Molecular Weight216.17 g/mol
Exact Mass216.05
IUPAC Name4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid
SMILESO=C(O)CCCn1c(=O)[nH]cc(F)c1=O
InChIInChI=1S/C8H9FN2O4/c9-5-4-10-8(15)11(7(5)14)3-1-2-6(12)13/h4H,1-3H2,(H,10,15)(H,12,13)
InChIKeyGAJZWVAXOWHLAX-UHFFFAOYSA-N
XLogP-0.46
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.17
LogP ≤ 5-0.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid?
The IUPAC name of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid (CID 58844107) is 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid.
What is the SMILES notation for 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid?
The canonical SMILES for 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid is O=C(O)CCCn1c(=O)[nH]cc(F)c1=O.
What is the InChIKey of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid?
The InChIKey is GAJZWVAXOWHLAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O4/c9-5-4-10-8(15)11(7(5)14)3-1-2-6(12)13/h4H,1-3H2,(H,10,15)(H,12,13).
What are the key properties of 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid?
4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid has a molecular weight of 216.17 g/mol, XLogP of -0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid is sourced from PubChem (CID 58844107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).