C40H44NO5PSi — CID 58844209
prop-2-enyl 2-[(2R,3S)-2-[2-(3-methylphenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 58844209) has the molecular formula C40H44NO5PSi and a molecular weight of 677.85 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3S)-2-[2-(3-methylphenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[(2R,3S)-2-[2-(3-methylphenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 58844209 |
| Molecular Formula | C40H44NO5PSi |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | prop-2-enyl 2-[(2R,3S)-2-[2-(3-methylphenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)C(N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C)[C@H]1CC(=O)c1cccc(C)c1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44NO5PSi/c1-7-26-45-40(44)39(47(32-20-11-8-12-21-32,33-22-13-9-14-23-33)34-24-15-10-16-25-34)41-35(28-36(42)31-19-17-18-29(2)27-31)37(38(41)43)30(3)46-48(4,5)6/h7-25,27,30,35,37H,1,26,28H2,2-6H3/t30-,35-,37-/m1/s1 |
| InChIKey | YPTMVFVJTZMRRF-XVQBCXLPSA-N |
| XLogP | 6.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|