C39H43N2O5PSi — CID 58844338
prop-2-enyl 2-[(2R,3S)-2-[2-(3-aminophenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 58844338) has the molecular formula C39H43N2O5PSi and a molecular weight of 678.84 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3S)-2-[2-(3-aminophenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[(2R,3S)-2-[2-(3-aminophenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 58844338 |
| Molecular Formula | C39H43N2O5PSi |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | prop-2-enyl 2-[(2R,3S)-2-[2-(3-aminophenyl)-2-oxoethyl]-4-oxo-3-[(1R)-1-trimethylsilyloxyethyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)C(N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C)[C@H]1CC(=O)c1cccc(N)c1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H43N2O5PSi/c1-6-25-45-39(44)38(47(31-19-10-7-11-20-31,32-21-12-8-13-22-32)33-23-14-9-15-24-33)41-34(27-35(42)29-17-16-18-30(40)26-29)36(37(41)43)28(2)46-48(3,4)5/h6-24,26,28,34,36H,1,25,27,40H2,2-5H3/t28-,34-,36-/m1/s1 |
| InChIKey | RFOJAIUWANNKKI-YOBZMKHOSA-N |
| XLogP | 5.76 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|