C24H33N3O5Si — CID 58844445
prop-2-enyl (5R,6S)-3-[4-(ethylcarbamoylamino)phenyl]-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 58844445) has the molecular formula C24H33N3O5Si and a molecular weight of 471.63 g/mol. Its IUPAC name is prop-2-enyl (5R,6S)-3-[4-(ethylcarbamoylamino)phenyl]-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (5R,6S)-3-[4-(ethylcarbamoylamino)phenyl]-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 58844445 |
| Molecular Formula | C24H33N3O5Si |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | prop-2-enyl (5R,6S)-3-[4-(ethylcarbamoylamino)phenyl]-7-oxo-6-[(1R)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)C1=C(c2ccc(NC(=O)NCC)cc2)C[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C24H33N3O5Si/c1-7-13-31-23(29)21-18(16-9-11-17(12-10-16)26-24(30)25-8-2)14-19-20(22(28)27(19)21)15(3)32-33(4,5)6/h7,9-12,15,19-20H,1,8,13-14H2,2-6H3,(H2,25,26,30)/t15-,19-,20-/m1/s1 |
| InChIKey | AICXGEYWTQFQAF-CDHQVMDDSA-N |
| XLogP | 3.74 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|