C24H31N3O6 — CID 58844554
2,2-dimethylpropanoyloxymethyl (5R,6S)-3-[3-[(1-aminoethylideneamino)methyl]phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 58844554) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (5R,6S)-3-[3-[(1-aminoethylideneamino)methyl]phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (5R,6S)-3-[3-[(1-aminoethylideneamino)methyl]phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 58844554 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (5R,6S)-3-[3-[(1-aminoethylideneamino)methyl]phenyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C/C(N)=N\Cc1cccc(C2=C(C(=O)OCOC(=O)C(C)(C)C)N3C(=O)[C@H]([C@@H](C)O)[C@H]3C2)c1 |
| InChI | InChI=1S/C24H31N3O6/c1-13(28)19-18-10-17(16-8-6-7-15(9-16)11-26-14(2)25)20(27(18)21(19)29)22(30)32-12-33-23(31)24(3,4)5/h6-9,13,18-19,28H,10-12H2,1-5H3,(H2,25,26)/t13-,18-,19-/m1/s1 |
| InChIKey | FDBGXLSVCQHPRI-UPRAQXHNSA-N |
| XLogP | 1.98 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|