C25H31F3N6O2 — CID 58845193
(7aS)-2-[4-[(2R)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 58845193) has the molecular formula C25H31F3N6O2 and a molecular weight of 504.56 g/mol. Its IUPAC name is (7aS)-2-[4-[(2R)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aS)-2-[4-[(2R)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 58845193 |
| Molecular Formula | C25H31F3N6O2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (7aS)-2-[4-[(2R)-2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]propyl]phenyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CCN(CC)c1ncc(CC(F)(F)F)c(N[C@H](C)Cc2ccc(N3C(=O)[C@@H]4CCCN4C3=O)cc2)n1 |
| InChI | InChI=1S/C25H31F3N6O2/c1-4-32(5-2)23-29-15-18(14-25(26,27)28)21(31-23)30-16(3)13-17-8-10-19(11-9-17)34-22(35)20-7-6-12-33(20)24(34)36/h8-11,15-16,20H,4-7,12-14H2,1-3H3,(H,29,30,31)/t16-,20+/m1/s1 |
| InChIKey | QCXSVNGLLUTCCO-UZLBHIALSA-N |
| XLogP | 4.40 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|