About (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine
(E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine (PubChem CID 58845207) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine |
| PubChem CID | 58845207 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine |
| SMILES | [H]/N=C/C(=C\C=N\C)N(C)C |
| InChI | InChI=1S/C7H13N3/c1-9-5-4-7(6-8)10(2)3/h4-6,8H,1-3H3/b7-4+,8-6+,9-5+ |
| InChIKey | SLOXUOLCQPXUPB-WXYQZPBCSA-N |
| XLogP | 0.78 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine?
The IUPAC name of (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine (CID 58845207) is (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine.
What is the SMILES notation for (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine?
The canonical SMILES for (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine is [H]/N=C/C(=C\C=N\C)N(C)C.
What is the InChIKey of (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine?
The InChIKey is SLOXUOLCQPXUPB-WXYQZPBCSA-N. The full InChI is InChI=1S/C7H13N3/c1-9-5-4-7(6-8)10(2)3/h4-6,8H,1-3H3/b7-4+,8-6+,9-5+.
What are the key properties of (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine?
(E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine has a molecular weight of 139.20 g/mol, XLogP of 0.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-imino-N,N-dimethyl-4-methyliminobut-2-en-2-amine is sourced from PubChem (CID 58845207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).