C18H21N7O — CID 58845501
(2S)-1-[2-[[3-[(4,5-diisocyanoimidazol-1-yl)methyl]cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 58845501) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is (2S)-1-[2-[[3-[(4,5-diisocyanoimidazol-1-yl)methyl]cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[[3-[(4,5-diisocyanoimidazol-1-yl)methyl]cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 58845501 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-1-[2-[[3-[(4,5-diisocyanoimidazol-1-yl)methyl]cyclopentyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | [C-]#[N+]c1ncn(CC2CCC(NCC(=O)N3CCC[C@H]3C#N)C2)c1[N+]#[C-] |
| InChI | InChI=1S/C18H21N7O/c1-20-17-18(21-2)24(12-23-17)11-13-5-6-14(8-13)22-10-16(26)25-7-3-4-15(25)9-19/h12-15,22H,3-8,10-11H2/t13?,14?,15-/m0/s1 |
| InChIKey | QTTWPMVFPHACGT-NRXISQOPSA-N |
| XLogP | 2.26 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|