About methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid
methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid (PubChem CID 58845539) has the molecular formula C7H16BNO
and a molecular weight of 141.02 g/mol. Its IUPAC name is methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid.
Molecular Properties
| Compound Name | methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid |
| PubChem CID | 58845539 |
| Molecular Formula | C7H16BNO |
| Molecular Weight | 141.02 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid |
| SMILES | CB(O)N[C@H]1CC[C@@H](C)C1 |
| InChI | InChI=1S/C7H16BNO/c1-6-3-4-7(5-6)9-8(2)10/h6-7,9-10H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | ZYRKGQQXNQLSDM-RQJHMYQMSA-N |
| XLogP | 0.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.02 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid?
The IUPAC name of methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid (CID 58845539) is methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid.
What is the SMILES notation for methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid?
The canonical SMILES for methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid is CB(O)N[C@H]1CC[C@@H](C)C1.
What is the InChIKey of methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid?
The InChIKey is ZYRKGQQXNQLSDM-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H16BNO/c1-6-3-4-7(5-6)9-8(2)10/h6-7,9-10H,3-5H2,1-2H3/t6-,7+/m1/s1.
What are the key properties of methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid?
methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid has a molecular weight of 141.02 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-N-[(1S,3R)-3-methylcyclopentyl]boronamidic acid is sourced from PubChem (CID 58845539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).