About (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine
(2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine (PubChem CID 58846279) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine.
Molecular Properties
| Compound Name | (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| PubChem CID | 58846279 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| SMILES | CC(C)[C@H](CN)Cc1nccs1 |
| InChI | InChI=1S/C9H16N2S/c1-7(2)8(6-10)5-9-11-3-4-12-9/h3-4,7-8H,5-6,10H2,1-2H3/t8-/m0/s1 |
| InChIKey | UNOVPDAOBRWTME-QMMMGPOBSA-N |
| XLogP | 1.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The IUPAC name of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine (CID 58846279) is (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine.
What is the SMILES notation for (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The canonical SMILES for (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine is CC(C)[C@H](CN)Cc1nccs1.
What is the InChIKey of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The InChIKey is UNOVPDAOBRWTME-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H16N2S/c1-7(2)8(6-10)5-9-11-3-4-12-9/h3-4,7-8H,5-6,10H2,1-2H3/t8-/m0/s1.
What are the key properties of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
(2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine has a molecular weight of 184.31 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine is sourced from PubChem (CID 58846279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).