C41H75NO3 — CID 58846406
(E)-N-[(E)-2,5,6,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8-pentamethyl-5-oxonon-2-enamide (PubChem CID 58846406) has the molecular formula C41H75NO3 and a molecular weight of 630.06 g/mol. Its IUPAC name is (E)-N-[(E)-2,5,6,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8-pentamethyl-5-oxonon-2-enamide.
| Compound Name | (E)-N-[(E)-2,5,6,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8-pentamethyl-5-oxonon-2-enamide |
|---|---|
| PubChem CID | 58846406 |
| Molecular Formula | C41H75NO3 |
| Molecular Weight | 630.06 g/mol |
| Exact Mass | 629.57 |
| IUPAC Name | (E)-N-[(E)-2,5,6,6,8,9,10,13,14,16-decamethyl-15-oxoheptadec-7-en-4-yl]-4,4,6,7,8-pentamethyl-5-oxonon-2-enamide |
| SMILES | C/C(=C\C(C)(C)C(C)C(CC(C)C)NC(=O)/C=C/C(C)(C)C(=O)C(C)C(C)C(C)C)C(C)C(C)CCC(C)C(C)C(=O)C(C)C |
| InChI | InChI=1S/C41H75NO3/c1-25(2)23-36(42-37(43)21-22-40(15,16)39(45)34(13)31(10)26(3)4)35(14)41(17,18)24-30(9)32(11)28(7)19-20-29(8)33(12)38(44)27(5)6/h21-22,24-29,31-36H,19-20,23H2,1-18H3,(H,42,43)/b22-21+,30-24+ |
| InChIKey | HCMMALGCCCQRQF-PYIQNQAJSA-N |
| XLogP | 10.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.06 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|