About 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate
3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate (PubChem CID 58846495) has the molecular formula C22H42O8Si2
and a molecular weight of 490.74 g/mol. Its IUPAC name is 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate.
Molecular Properties
| Compound Name | 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate |
| PubChem CID | 58846495 |
| Molecular Formula | C22H42O8Si2 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate |
| SMILES | COC(=O)CCC[Si](C)(C)O[Si](C)(C)CCCC(=O)OCCCOC(=O)CCCC(C)=O |
| InChI | InChI=1S/C22H42O8Si2/c1-19(23)11-7-12-21(25)28-15-10-16-29-22(26)14-9-18-32(5,6)30-31(3,4)17-8-13-20(24)27-2/h7-18H2,1-6H3 |
| InChIKey | RCSUUOAKIHDYIB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate?
The IUPAC name of 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate (CID 58846495) is 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate.
What is the SMILES notation for 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate?
The canonical SMILES for 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate is COC(=O)CCC[Si](C)(C)O[Si](C)(C)CCCC(=O)OCCCOC(=O)CCCC(C)=O.
What is the InChIKey of 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate?
The InChIKey is RCSUUOAKIHDYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O8Si2/c1-19(23)11-7-12-21(25)28-15-10-16-29-22(26)14-9-18-32(5,6)30-31(3,4)17-8-13-20(24)27-2/h7-18H2,1-6H3.
What are the key properties of 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate?
3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate has a molecular weight of 490.74 g/mol, XLogP of 4.38, 18 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(4-methoxy-4-oxobutyl)-dimethylsilyl]oxy-dimethylsilyl]butanoyloxy]propyl 5-oxohexanoate is sourced from PubChem (CID 58846495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).