About [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate
[2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate (PubChem CID 58846508) has the molecular formula C21H33NO3
and a molecular weight of 347.50 g/mol. Its IUPAC name is [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate.
Molecular Properties
| Compound Name | [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate |
| PubChem CID | 58846508 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate |
| SMILES | CCC1(C)CC(OC(C)=O)CC(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C21H33NO3/c1-7-20(5)14-19(24-17(4)23)15-21(6,8-2)22(20)25-16(3)18-12-10-9-11-13-18/h9-13,16,19H,7-8,14-15H2,1-6H3 |
| InChIKey | ADOZRFXULJAPNK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate?
The IUPAC name of [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate (CID 58846508) is [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate.
What is the SMILES notation for [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate?
The canonical SMILES for [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate is CCC1(C)CC(OC(C)=O)CC(C)(CC)N1OC(C)c1ccccc1.
What is the InChIKey of [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate?
The InChIKey is ADOZRFXULJAPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO3/c1-7-20(5)14-19(24-17(4)23)15-21(6,8-2)22(20)25-16(3)18-12-10-9-11-13-18/h9-13,16,19H,7-8,14-15H2,1-6H3.
What are the key properties of [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate?
[2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate has a molecular weight of 347.50 g/mol, XLogP of 5.04, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-diethyl-2,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] acetate is sourced from PubChem (CID 58846508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).