About 4-isocyano-3,5-dimethyl-1,2-thiazole
4-isocyano-3,5-dimethyl-1,2-thiazole (PubChem CID 58846745) has the molecular formula C6H6N2S
and a molecular weight of 138.19 g/mol. Its IUPAC name is 4-isocyano-3,5-dimethyl-1,2-thiazole.
Molecular Properties
| Compound Name | 4-isocyano-3,5-dimethyl-1,2-thiazole |
| PubChem CID | 58846745 |
| Molecular Formula | C6H6N2S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 4-isocyano-3,5-dimethyl-1,2-thiazole |
| SMILES | [C-]#[N+]c1c(C)nsc1C |
| InChI | InChI=1S/C6H6N2S/c1-4-6(7-3)5(2)9-8-4/h1-2H3 |
| InChIKey | MPGISXRQIISSMF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-3,5-dimethyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-3,5-dimethyl-1,2-thiazole?
The IUPAC name of 4-isocyano-3,5-dimethyl-1,2-thiazole (CID 58846745) is 4-isocyano-3,5-dimethyl-1,2-thiazole.
What is the SMILES notation for 4-isocyano-3,5-dimethyl-1,2-thiazole?
The canonical SMILES for 4-isocyano-3,5-dimethyl-1,2-thiazole is [C-]#[N+]c1c(C)nsc1C.
What is the InChIKey of 4-isocyano-3,5-dimethyl-1,2-thiazole?
The InChIKey is MPGISXRQIISSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2S/c1-4-6(7-3)5(2)9-8-4/h1-2H3.
What are the key properties of 4-isocyano-3,5-dimethyl-1,2-thiazole?
4-isocyano-3,5-dimethyl-1,2-thiazole has a molecular weight of 138.19 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-3,5-dimethyl-1,2-thiazole is sourced from PubChem (CID 58846745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).