About carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium
carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium (PubChem CID 58846880) has the molecular formula C12H27N2O7PY-2
and a molecular weight of 431.24 g/mol. Its IUPAC name is carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium.
Molecular Properties
| Compound Name | carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium |
| PubChem CID | 58846880 |
| Molecular Formula | C12H27N2O7PY-2 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium |
| SMILES | [CH2-]NCCC(=O)NCCOP(=O)(O)OCC(COC)OC.[CH3-].[Y] |
| InChI | InChI=1S/C11H24N2O7P.CH3.Y/c1-12-5-4-11(14)13-6-7-19-21(15,16)20-9-10(18-3)8-17-2;;/h10,12H,1,4-9H2,2-3H3,(H,13,14)(H,15,16);1H3;/q2*-1; |
| InChIKey | MWDVRCIILWKKJL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium?
The IUPAC name of carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium (CID 58846880) is carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium.
What is the SMILES notation for carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium?
The canonical SMILES for carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium is [CH2-]NCCC(=O)NCCOP(=O)(O)OCC(COC)OC.[CH3-].[Y].
What is the InChIKey of carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium?
The InChIKey is MWDVRCIILWKKJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O7P.CH3.Y/c1-12-5-4-11(14)13-6-7-19-21(15,16)20-9-10(18-3)8-17-2;;/h10,12H,1,4-9H2,2-3H3,(H,13,14)(H,15,16);1H3;/q2*-1;.
What are the key properties of carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium?
carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium has a molecular weight of 431.24 g/mol, XLogP of 0.12, 13 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,3-dimethoxypropyl 2-[3-(methanidylamino)propanoylamino]ethyl hydrogen phosphate;yttrium is sourced from PubChem (CID 58846880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).