C9H7F3O3 — CID 58846959
3-(2,4-dihydroxyphenyl)-1,1,1-trifluoropropan-2-one (PubChem CID 58846959) has the molecular formula C9H7F3O3 and a molecular weight of 220.15 g/mol. Its IUPAC name is 3-(2,4-dihydroxyphenyl)-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-(2,4-dihydroxyphenyl)-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 58846959 |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(Cc1ccc(O)cc1O)C(F)(F)F |
| InChI | InChI=1S/C9H7F3O3/c10-9(11,12)8(15)3-5-1-2-6(13)4-7(5)14/h1-2,4,13-14H,3H2 |
| InChIKey | IMTXPMNXYBPQQP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |