C27H42O5 — CID 58846981
[3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 58846981) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is [3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58846981 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [3,7-dimethyl-8-[2-(6-oxo-4-propan-2-yloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(OC(C)C)CC(=O)O3)C21 |
| InChI | InChI=1S/C27H42O5/c1-7-18(5)27(29)32-24-13-17(4)12-20-9-8-19(6)23(26(20)24)11-10-21-14-22(30-16(2)3)15-25(28)31-21/h8-9,12,16-19,21-24,26H,7,10-11,13-15H2,1-6H3 |
| InChIKey | VGKGFYMCCIVWRJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |