C21H21N5O4 — CID 58847041
(2'R,4'S,4'aS)-2',4'-dimethyl-8'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 58847041) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-2',4'-dimethyl-8'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (2'R,4'S,4'aS)-2',4'-dimethyl-8'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 58847041 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (2'R,4'S,4'aS)-2',4'-dimethyl-8'-pyrimidin-2-ylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ccc(-c4ncccn4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C21H21N5O4/c1-11-10-26-15-5-4-13(17-22-6-3-7-23-17)8-14(15)9-21(16(26)12(2)30-11)18(27)24-20(29)25-19(21)28/h3-8,11-12,16H,9-10H2,1-2H3,(H2,24,25,27,28,29)/t11-,12+,16-/m1/s1 |
| InChIKey | GQUVXATTXCQZBS-BFQNTYOBSA-N |
| XLogP | 1.03 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|