C24H23N5O4 — CID 58847065
(2'R,4'S,4'aS)-8'-indazol-1-yl-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 58847065) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-8'-indazol-1-yl-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (2'R,4'S,4'aS)-8'-indazol-1-yl-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 58847065 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2'R,4'S,4'aS)-8'-indazol-1-yl-2',4'-dimethylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ccc(-n4ncc5ccccc54)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C24H23N5O4/c1-13-12-28-18-8-7-17(29-19-6-4-3-5-15(19)11-25-29)9-16(18)10-24(20(28)14(2)33-13)21(30)26-23(32)27-22(24)31/h3-9,11,13-14,20H,10,12H2,1-2H3,(H2,26,27,30,31,32)/t13-,14+,20-/m1/s1 |
| InChIKey | SCWSDYLKKYLXOM-LAPQFRIASA-N |
| XLogP | 1.92 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|