C15H18BrF2NO3 — CID 58847137
(2S,6R)-4-[4-bromo-6-(1,3-dioxolan-2-yl)-2,3-difluorophenyl]-2,6-dimethylmorpholine (PubChem CID 58847137) has the molecular formula C15H18BrF2NO3 and a molecular weight of 378.21 g/mol. Its IUPAC name is (2S,6R)-4-[4-bromo-6-(1,3-dioxolan-2-yl)-2,3-difluorophenyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[4-bromo-6-(1,3-dioxolan-2-yl)-2,3-difluorophenyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 58847137 |
| Molecular Formula | C15H18BrF2NO3 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2S,6R)-4-[4-bromo-6-(1,3-dioxolan-2-yl)-2,3-difluorophenyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2c(C3OCCO3)cc(Br)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18BrF2NO3/c1-8-6-19(7-9(2)22-8)14-10(15-20-3-4-21-15)5-11(16)12(17)13(14)18/h5,8-9,15H,3-4,6-7H2,1-2H3/t8-,9+ |
| InChIKey | RPEIZBMRSATVBE-DTORHVGOSA-N |
| XLogP | 3.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|