C18H21N3O5S — CID 58847192
(2'R,4'S,4'aS)-2',4'-dimethyl-8'-methylsulfinylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 58847192) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-2',4'-dimethyl-8'-methylsulfinylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (2'R,4'S,4'aS)-2',4'-dimethyl-8'-methylsulfinylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 58847192 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (2'R,4'S,4'aS)-2',4'-dimethyl-8'-methylsulfinylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ccc(S(C)=O)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C18H21N3O5S/c1-9-8-21-13-5-4-12(27(3)25)6-11(13)7-18(14(21)10(2)26-9)15(22)19-17(24)20-16(18)23/h4-6,9-10,14H,7-8H2,1-3H3,(H2,19,20,22,23,24)/t9-,10+,14-,27?/m1/s1 |
| InChIKey | MHUOIPHVXSJKLY-NQJKKYBHSA-N |
| XLogP | 0.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|