C17H18N8O4 — CID 58847213
(6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2H-tetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,7]naphthyridine]-2,4,6-trione (PubChem CID 58847213) has the molecular formula C17H18N8O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2H-tetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,7]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2H-tetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,7]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 58847213 |
| Molecular Formula | C17H18N8O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (6'aS,7'S,9'R)-7',9'-dimethyl-3'-(2H-tetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,7]naphthyridine]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3cnc(-c4nn[nH]n4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C17H18N8O4/c1-7-6-25-11-5-18-10(13-21-23-24-22-13)3-9(11)4-17(12(25)8(2)29-7)14(26)19-16(28)20-15(17)27/h3,5,7-8,12H,4,6H2,1-2H3,(H,21,22,23,24)(H2,19,20,26,27,28)/t7-,8+,12-/m1/s1 |
| InChIKey | QBVZSMPIGNVVCM-RGNHYFCHSA-N |
| XLogP | -0.85 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|