C25H24ClFN4O5 — CID 58847221
(2'R,4'S,4'aS)-N-[(3-chloro-4-fluorophenyl)methyl]-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-8'-carboxamide (PubChem CID 58847221) has the molecular formula C25H24ClFN4O5 and a molecular weight of 514.94 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-N-[(3-chloro-4-fluorophenyl)methyl]-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-8'-carboxamide.
| Compound Name | (2'R,4'S,4'aS)-N-[(3-chloro-4-fluorophenyl)methyl]-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-8'-carboxamide |
|---|---|
| PubChem CID | 58847221 |
| Molecular Formula | C25H24ClFN4O5 |
| Molecular Weight | 514.94 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (2'R,4'S,4'aS)-N-[(3-chloro-4-fluorophenyl)methyl]-2',4'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-8'-carboxamide |
| SMILES | C[C@@H]1CN2c3ccc(C(=O)NCc4ccc(F)c(Cl)c4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C25H24ClFN4O5/c1-12-11-31-19-6-4-15(21(32)28-10-14-3-5-18(27)17(26)7-14)8-16(19)9-25(20(31)13(2)36-12)22(33)29-24(35)30-23(25)34/h3-8,12-13,20H,9-11H2,1-2H3,(H,28,32)(H2,29,30,33,34,35)/t12-,13+,20-/m1/s1 |
| InChIKey | PQIQAZXVZWMEBU-MTJIALIYSA-N |
| XLogP | 2.30 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|