About 5-isocyano-1,3-dimethylindazole
5-isocyano-1,3-dimethylindazole (PubChem CID 58847572) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 5-isocyano-1,3-dimethylindazole.
Molecular Properties
| Compound Name | 5-isocyano-1,3-dimethylindazole |
| PubChem CID | 58847572 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 5-isocyano-1,3-dimethylindazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(C)nn2C |
| InChI | InChI=1S/C10H9N3/c1-7-9-6-8(11-2)4-5-10(9)13(3)12-7/h4-6H,1,3H3 |
| InChIKey | ZFZQHYJUNQXCOJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyano-1,3-dimethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyano-1,3-dimethylindazole?
The IUPAC name of 5-isocyano-1,3-dimethylindazole (CID 58847572) is 5-isocyano-1,3-dimethylindazole.
What is the SMILES notation for 5-isocyano-1,3-dimethylindazole?
The canonical SMILES for 5-isocyano-1,3-dimethylindazole is [C-]#[N+]c1ccc2c(c1)c(C)nn2C.
What is the InChIKey of 5-isocyano-1,3-dimethylindazole?
The InChIKey is ZFZQHYJUNQXCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-7-9-6-8(11-2)4-5-10(9)13(3)12-7/h4-6H,1,3H3.
What are the key properties of 5-isocyano-1,3-dimethylindazole?
5-isocyano-1,3-dimethylindazole has a molecular weight of 171.20 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyano-1,3-dimethylindazole is sourced from PubChem (CID 58847572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).