C25H34O10S — CID 58849477
[(3R,4S,6R)-3,4,5-triacetyloxy-6-(4-benzylsulfanylbutoxy)oxan-2-yl]methyl acetate (PubChem CID 58849477) has the molecular formula C25H34O10S and a molecular weight of 526.60 g/mol. Its IUPAC name is [(3R,4S,6R)-3,4,5-triacetyloxy-6-(4-benzylsulfanylbutoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-3,4,5-triacetyloxy-6-(4-benzylsulfanylbutoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58849477 |
| Molecular Formula | C25H34O10S |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [(3R,4S,6R)-3,4,5-triacetyloxy-6-(4-benzylsulfanylbutoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OCCCCSCc2ccccc2)C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H34O10S/c1-16(26)31-14-21-22(32-17(2)27)23(33-18(3)28)24(34-19(4)29)25(35-21)30-12-8-9-13-36-15-20-10-6-5-7-11-20/h5-7,10-11,21-25H,8-9,12-15H2,1-4H3/t21?,22-,23+,24?,25-/m1/s1 |
| InChIKey | MLDBURQKQCXOTE-OCYQVPGMSA-N |
| XLogP | 2.80 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|