About 3,7-dibromodibenzothiophene-2,8-diol
3,7-dibromodibenzothiophene-2,8-diol (PubChem CID 58849626) has the molecular formula C12H6Br2O2S
and a molecular weight of 374.05 g/mol. Its IUPAC name is 3,7-dibromodibenzothiophene-2,8-diol.
Molecular Properties
| Compound Name | 3,7-dibromodibenzothiophene-2,8-diol |
| PubChem CID | 58849626 |
| Molecular Formula | C12H6Br2O2S |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 371.85 |
| IUPAC Name | 3,7-dibromodibenzothiophene-2,8-diol |
| SMILES | Oc1cc2c(cc1Br)sc1cc(Br)c(O)cc12 |
| InChI | InChI=1S/C12H6Br2O2S/c13-7-3-11-5(1-9(7)15)6-2-10(16)8(14)4-12(6)17-11/h1-4,15-16H |
| InChIKey | VLRXFXRZWGHABL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dibromodibenzothiophene-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dibromodibenzothiophene-2,8-diol?
The IUPAC name of 3,7-dibromodibenzothiophene-2,8-diol (CID 58849626) is 3,7-dibromodibenzothiophene-2,8-diol.
What is the SMILES notation for 3,7-dibromodibenzothiophene-2,8-diol?
The canonical SMILES for 3,7-dibromodibenzothiophene-2,8-diol is Oc1cc2c(cc1Br)sc1cc(Br)c(O)cc12.
What is the InChIKey of 3,7-dibromodibenzothiophene-2,8-diol?
The InChIKey is VLRXFXRZWGHABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br2O2S/c13-7-3-11-5(1-9(7)15)6-2-10(16)8(14)4-12(6)17-11/h1-4,15-16H.
What are the key properties of 3,7-dibromodibenzothiophene-2,8-diol?
3,7-dibromodibenzothiophene-2,8-diol has a molecular weight of 374.05 g/mol, XLogP of 4.99, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dibromodibenzothiophene-2,8-diol is sourced from PubChem (CID 58849626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).