C15H23NS — CID 58849853
2,3-ditert-butyl-2,3-dihydrothieno[2,3-b]pyridine (PubChem CID 58849853) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 2,3-ditert-butyl-2,3-dihydrothieno[2,3-b]pyridine.
| Compound Name | 2,3-ditert-butyl-2,3-dihydrothieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 58849853 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2,3-ditert-butyl-2,3-dihydrothieno[2,3-b]pyridine |
| SMILES | CC(C)(C)C1Sc2ncccc2C1C(C)(C)C |
| InChI | InChI=1S/C15H23NS/c1-14(2,3)11-10-8-7-9-16-13(10)17-12(11)15(4,5)6/h7-9,11-12H,1-6H3 |
| InChIKey | KRZBBSGSKZTNIK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |