C9H15NO2S — CID 58849865
1-(4-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]thiazin-3-yl)ethanone (PubChem CID 58849865) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-(4-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]thiazin-3-yl)ethanone.
| Compound Name | 1-(4-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]thiazin-3-yl)ethanone |
|---|---|
| PubChem CID | 58849865 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-(4-methyl-2,3,4a,5,7,7a-hexahydrofuro[3,4-b][1,4]thiazin-3-yl)ethanone |
| SMILES | CC(=O)C1CSC2COCC2N1C |
| InChI | InChI=1S/C9H15NO2S/c1-6(11)8-5-13-9-4-12-3-7(9)10(8)2/h7-9H,3-5H2,1-2H3 |
| InChIKey | UNGAOYXHFGWSMU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |