C21H41N3 — CID 58849867
3,4,5-tritert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane (PubChem CID 58849867) has the molecular formula C21H41N3 and a molecular weight of 335.58 g/mol. Its IUPAC name is 3,4,5-tritert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 3,4,5-tritert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 58849867 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 3,4,5-tritert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC(C)(C)C1C2C3CCNCC3NC2N(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C21H41N3/c1-19(2,3)16-15-13-10-11-22-12-14(13)23-18(15)24(21(7,8)9)17(16)20(4,5)6/h13-18,22-23H,10-12H2,1-9H3 |
| InChIKey | FKKSNMWPIISROX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |