C22H42N2 — CID 58849887
1,2,3-tritert-butyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-pyrrolo[2,3-b]indole (PubChem CID 58849887) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 1,2,3-tritert-butyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 1,2,3-tritert-butyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 58849887 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | 1,2,3-tritert-butyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-pyrrolo[2,3-b]indole |
| SMILES | CC(C)(C)C1C2C3CCCCC3NC2N(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C22H42N2/c1-20(2,3)17-16-14-12-10-11-13-15(14)23-19(16)24(22(7,8)9)18(17)21(4,5)6/h14-19,23H,10-13H2,1-9H3 |
| InChIKey | YMZKBBJANCOQSR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |